ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4458-33-7 डी-एन-ब्यूटाइलथाइलामाइन |
|
उत्पाद का नाम | डी-एन-ब्यूटाइलथाइलामाइन |
समानार्थी | एन-एथिलडिब्यूटाइलमाइन; एन-ब्यूटाइल-एन-एथिलबुटन-1-एमाइन; |
अंग्रेज | Di-n-butylethylamine;N-Ethyldibutylamine;N-butyl-N-ethylbutan-1-amine |
आणविक फार्मूला | C10H23N |
आण्विक वजन | 157.2963 |
InChI | InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
कैस रजिस्टी संख्या | 4458-33-7 |
EINECS | 224-711-2 |
आणविक संरचना | ![]() |
घनत्व | 0.783g/cm3 |
उबलने का समय | 182.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.432 |
फ्लैश प्वाइंट | 52.6°C |
वाष्प का दबाव | 0.795mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |