ChemIndex - Une base de données CAS chimique gratuiteToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4461-41-0 2-chloro-2-butene, mixture of cis and trans |
|
| Nom | 2-chloro-2-butene, mixture of cis and trans |
| Nom anglais | 2-chloro-2-butene, mixture of cis and trans; |
| Formule moléculaire | C4H7Cl |
| Poids Moléculaire | 90.5514 |
| InChl | InChI=1/C4H7Cl/c1-3-4(2)5/h3H,1-2H3 |
| Numéro de registre CAS | 4461-41-0 |
| EINECS | 224-719-6 |
| Structure moléculaire | ![]() |
| Densité | 0.911g/cm3 |
| Point d'ébullition | 70.6°C at 760 mmHg |
| Indice de réfraction | 1.423 |
| Pression de vapeur | 139mmHg at 25°C |
| MSDS | |