ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4461-41-0 2-chloro-2-butene, mixture of cis and trans |
|
produktnavn | 2-chloro-2-butene, mixture of cis and trans |
Engelsk navn | 2-chloro-2-butene, mixture of cis and trans; |
Molekylær Formel | C4H7Cl |
Molekylvekt | 90.5514 |
InChI | InChI=1/C4H7Cl/c1-3-4(2)5/h3H,1-2H3 |
CAS-nummer | 4461-41-0 |
EINECS | 224-719-6 |
Molecular Structure | ![]() |
Tetthet | 0.911g/cm3 |
Kokepunkt | 70.6°C at 760 mmHg |
Brytningsindeks | 1.423 |
Damptrykk | 139mmHg at 25°C |
MSDS |