ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4461-41-0 2-chloro-2-butene, mixture of cis and trans |
|
| Ονομασία του προϊόντος | 2-chloro-2-butene, mixture of cis and trans |
| Αγγλικό όνομα | 2-chloro-2-butene, mixture of cis and trans; |
| MF | C4H7Cl |
| Μοριακό βάρος | 90.5514 |
| InChI | InChI=1/C4H7Cl/c1-3-4(2)5/h3H,1-2H3 |
| CAS ΟΧΙ | 4461-41-0 |
| EINECS | 224-719-6 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 0.911g/cm3 |
| Σημείο βρασμού | 70.6°C at 760 mmHg |
| Δείκτης διάθλασης | 1.423 |
| Πίεση ατμών | 139mmHg at 25°C |
| MSDS | |