ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4461-41-0 2-chloro-2-butene, mixture of cis and trans |
|
שם המוצר | 2-chloro-2-butene, mixture of cis and trans |
שם אנגלי | 2-chloro-2-butene, mixture of cis and trans; |
מולקולרית פורמולה | C4H7Cl |
משקל מולקולרי | 90.5514 |
InChl | InChI=1/C4H7Cl/c1-3-4(2)5/h3H,1-2H3 |
מספר CAS | 4461-41-0 |
EINECS | 224-719-6 |
מבנה מולקולרי | ![]() |
צפיפות | 0.911g/cm3 |
נקודת רתיחה | 70.6°C at 760 mmHg |
משקל סגולי | 1.423 |
לחץ אדים | 139mmHg at 25°C |
MSDS |