ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4461-41-0 2-chloro-2-butene, mixture of cis and trans |
|
| उत्पाद का नाम | 2-chloro-2-butene, mixture of cis and trans |
| अंग्रेज | 2-chloro-2-butene, mixture of cis and trans; |
| आणविक फार्मूला | C4H7Cl |
| आण्विक वजन | 90.5514 |
| InChI | InChI=1/C4H7Cl/c1-3-4(2)5/h3H,1-2H3 |
| कैस रजिस्टी संख्या | 4461-41-0 |
| EINECS | 224-719-6 |
| आणविक संरचना | ![]() |
| घनत्व | 0.911g/cm3 |
| उबलने का समय | 70.6°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.423 |
| वाष्प का दबाव | 139mmHg at 25°C |
| MSDS | |