ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4461-41-0 2-chloro-2-butene, mixture of cis and trans |
|
| نام محصول | 2-chloro-2-butene, mixture of cis and trans |
| نام انگلیسی | 2-chloro-2-butene, mixture of cis and trans; |
| میدان مغناطیسی | C4H7Cl |
| وزن مولکولی | 90.5514 |
| InChI | InChI=1/C4H7Cl/c1-3-4(2)5/h3H,1-2H3 |
| شماره سیایاس | 4461-41-0 |
| تعداد کمیسیون اروپایی | 224-719-6 |
| ساختار مولکولی | ![]() |
| تراکم | 0.911g/cm3 |
| نقطه غلیان | 70.6°C at 760 mmHg |
| ضریب شکست | 1.423 |
| فشار بخار | 139mmHg at 25°C |
| MSDS | |