Chemindex > 127142-69-2
HU ▼
127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
|
| termék neve | 2,3,4-Trichlorophenyl isothiocyanate |
| Angol név | 2,3,4-Trichlorophenyl isothiocyanate;2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
| MF | C7H2Cl3NS |
| Molekulatömeg | 238.5215 |
| InChI | InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
| CAS-szám | 127142-69-2 |
| Molekuláris szerkezete |  |
| Sűrűség | 1.5g/cm3 |
| Forráspont | 335.4°C at 760 mmHg |
| Törésmutató | 1.633 |
| Gyulladáspont | 156.6°C |
| Gőznyomás | 0.000234mmHg at 25°C |
| Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
Beszállítók 127142-69-2 (0) -ért:
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 