Chemindex > 127142-69-2
SA ▼
127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
|
| اسم المنتج | 2,3,4-Trichlorophenyl isothiocyanate |
| الاسم بالانجليزية | 2,3,4-Trichlorophenyl isothiocyanate;2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
| الصيغة الجزيئية | C7H2Cl3NS |
| الوزن الجزيئي الغرامي | 238.5215 |
| InChI | InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
| إستراتيجية المساعدة القطرية | 127142-69-2 |
| بنية جزيئية |  |
| كثافة | 1.5g/cm3 |
| نقطة الغليان | 335.4°C at 760 mmHg |
| معامل الإنكسار | 1.633 |
| نقطة الوميض | 156.6°C |
| ضغط البخار | 0.000234mmHg at 25°C |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
موردون للدولار 127142-69-2 (0):
يتم توفير خدمة قاعدة بيانات CAS الكي&# 