Chemindex > 127142-69-2
IL ▼
127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
|
| שם המוצר | 2,3,4-Trichlorophenyl isothiocyanate |
| שם אנגלי | 2,3,4-Trichlorophenyl isothiocyanate;2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
| מולקולרית פורמולה | C7H2Cl3NS |
| משקל מולקולרי | 238.5215 |
| InChl | InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
| מספר CAS | 127142-69-2 |
| מבנה מולקולרי |  |
| צפיפות | 1.5g/cm3 |
| נקודת רתיחה | 335.4°C at 760 mmHg |
| משקל סגולי | 1.633 |
| נקודת הבזק | 156.6°C |
| לחץ אדים | 0.000234mmHg at 25°C |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 127142-69-2 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 