Chemindex > 127142-69-2
NO ▼
127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
|
| produktnavn | 2,3,4-Trichlorophenyl isothiocyanate |
| Engelsk navn | 2,3,4-Trichlorophenyl isothiocyanate;2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
| Molekylær Formel | C7H2Cl3NS |
| Molekylvekt | 238.5215 |
| InChI | InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
| CAS-nummer | 127142-69-2 |
| Molecular Structure |  |
| Tetthet | 1.5g/cm3 |
| Kokepunkt | 335.4°C at 760 mmHg |
| Brytningsindeks | 1.633 |
| Flammepunktet | 156.6°C |
| Damptrykk | 0.000234mmHg at 25°C |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 127142-69-2 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 