ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
|
Ürün Adı | 2,3,4-Trichlorophenyl isothiocyanate |
ingilizce adı | 2,3,4-Trichlorophenyl isothiocyanate;2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
Moleküler Formülü | C7H2Cl3NS |
Molekül Ağırlığı | 238.5215 |
InChI | InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
CAS kayıt numarası | 127142-69-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.5g/cm3 |
Kaynama noktası | 335.4°C at 760 mmHg |
Kırılma indisi | 1.633 |
Alevlenme noktası | 156.6°C |
Buhar basıncı | 0.000234mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |