ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
|
Nama produk | 2,3,4-Trichlorophenyl isothiocyanate |
Nama Inggeris | 2,3,4-Trichlorophenyl isothiocyanate;2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
MF | C7H2Cl3NS |
Berat Molekul | 238.5215 |
InChI | InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
CAS NO | 127142-69-2 |
Struktur Molekul | ![]() |
Kepadatan | 1.5g/cm3 |
Titik didih | 335.4°C at 760 mmHg |
Indeks bias | 1.633 |
Titik nyala | 156.6°C |
Tekanan wap | 0.000234mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |