Chemindex >127142-69-2
MY ▼
127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
|
| Nama produk | 2,3,4-Trichlorophenyl isothiocyanate |
| Nama Inggeris | 2,3,4-Trichlorophenyl isothiocyanate;2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
| MF | C7H2Cl3NS |
| Berat Molekul | 238.5215 |
| InChI | InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
| CAS NO | 127142-69-2 |
| Struktur Molekul |  |
| Kepadatan | 1.5g/cm3 |
| Titik didih | 335.4°C at 760 mmHg |
| Indeks bias | 1.633 |
| Titik nyala | 156.6°C |
| Tekanan wap | 0.000234mmHg at 25°C |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 127142-69-2 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 