ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52414-97-8 3-Bromo-2-nitrotoluene |
|
termék neve | 3-Bromo-2-nitrotoluene |
Angol név | 3-Bromo-2-nitrotoluene;Benzene, 1-bromo-3-methyl-2-nitro-;1-bromo-3-methyl-2-nitrobenzene;3-Bromo-2-nitrobenzene |
MF | C7H6BrNO2 |
Molekulatömeg | 216.032 |
InChI | InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
CAS-szám | 52414-97-8 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.615g/cm3 |
Olvadáspont | 26.8-29℃ |
Forráspont | 237.4°C at 760 mmHg |
Törésmutató | 1.592 |
Gyulladáspont | 97.4°C |
Gőznyomás | 0.0689mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
Biztonsági Leírás | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |