Chemindex > 52414-97-8
PL ▼
52414-97-8 3-Bromo-2-nitrotoluene |
|
| Nazwa produktu: | 3-Bromo-2-nitrotoluene |
| Angielska nazwa | 3-Bromo-2-nitrotoluene;Benzene, 1-bromo-3-methyl-2-nitro-;1-bromo-3-methyl-2-nitrobenzene;3-Bromo-2-nitrobenzene |
| MF | C7H6BrNO2 |
| Masie cząsteczkowej | 216.032 |
| InChI | InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
| Nr CAS | 52414-97-8 |
| Struktury molekularnej |  |
| Gęstość | 1.615g/cm3 |
| Temperatura topnienia | 26.8-29℃ |
| Temperatura wrzenia | 237.4°C at 760 mmHg |
| Współczynnik załamania | 1.592 |
| Temperatura zapłonu | 97.4°C |
| Ciśnienie pary | 0.0689mmHg at 25°C |
| Symbole zagrożenia |  T##Toxic:; |
| Kody ryzyka | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Bezpieczeństwo opis | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 