Chemindex >52414-97-8
MY ▼
52414-97-8 3-Bromo-2-nitrotoluene |
|
| Nama produk | 3-Bromo-2-nitrotoluene |
| Nama Inggeris | 3-Bromo-2-nitrotoluene;Benzene, 1-bromo-3-methyl-2-nitro-;1-bromo-3-methyl-2-nitrobenzene;3-Bromo-2-nitrobenzene |
| MF | C7H6BrNO2 |
| Berat Molekul | 216.032 |
| InChI | InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
| CAS NO | 52414-97-8 |
| Struktur Molekul |  |
| Kepadatan | 1.615g/cm3 |
| Titik lebur | 26.8-29℃ |
| Titik didih | 237.4°C at 760 mmHg |
| Indeks bias | 1.592 |
| Titik nyala | 97.4°C |
| Tekanan wap | 0.0689mmHg at 25°C |
| Cinta bahaya |  T##Toxic:; |
| Kod Risiko | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Keselamatan Penerangan | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 