Chemindex > 52414-97-8
ID ▼
52414-97-8 3-Bromo-2-nitrotoluene |
|
| Nama produk | 3-Bromo-2-nitrotoluene |
| Nama bahasa Inggris | 3-Bromo-2-nitrotoluene;Benzene, 1-bromo-3-methyl-2-nitro-;1-bromo-3-methyl-2-nitrobenzene;3-Bromo-2-nitrobenzene |
| MF | C7H6BrNO2 |
| Berat Molekul | 216.032 |
| InChI | InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
| CAS NO | 52414-97-8 |
| Struktur Molekul |  |
| Kepadatan | 1.615g/cm3 |
| Titik lebur | 26.8-29℃ |
| Titik didih | 237.4°C at 760 mmHg |
| Indeks bias | 1.592 |
| Titik nyala | 97.4°C |
| Tekanan uap | 0.0689mmHg at 25°C |
| Simbol bahaya |  T##Toxic:; |
| Kode Risiko | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Keselamatan Deskripsi | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 