ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52414-97-8 3-Bromo-2-nitrotoluene |
|
نام محصول | 3-Bromo-2-nitrotoluene |
نام انگلیسی | 3-Bromo-2-nitrotoluene;Benzene, 1-bromo-3-methyl-2-nitro-;1-bromo-3-methyl-2-nitrobenzene;3-Bromo-2-nitrobenzene |
میدان مغناطیسی | C7H6BrNO2 |
وزن مولکولی | 216.032 |
InChI | InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
شماره سیایاس | 52414-97-8 |
ساختار مولکولی | ![]() |
تراکم | 1.615g/cm3 |
نقطه ذوب | 26.8-29℃ |
نقطه غلیان | 237.4°C at 760 mmHg |
ضریب شکست | 1.592 |
نقطه اشتعال | 97.4°C |
فشار بخار | 0.0689mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
توضیحات ایمنی | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |