ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52414-97-8 3-Bromo-2-nitrotoluene |
|
שם המוצר | 3-Bromo-2-nitrotoluene |
שם אנגלי | 3-Bromo-2-nitrotoluene;Benzene, 1-bromo-3-methyl-2-nitro-;1-bromo-3-methyl-2-nitrobenzene;3-Bromo-2-nitrobenzene |
מולקולרית פורמולה | C7H6BrNO2 |
משקל מולקולרי | 216.032 |
InChl | InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
מספר CAS | 52414-97-8 |
מבנה מולקולרי | ![]() |
צפיפות | 1.615g/cm3 |
נקודת ההתוך | 26.8-29℃ |
נקודת רתיחה | 237.4°C at 760 mmHg |
משקל סגולי | 1.592 |
נקודת הבזק | 97.4°C |
לחץ אדים | 0.0689mmHg at 25°C |
Hazard סימנים | |
סיכונים קודי | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
בטיחות תיאור | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |