ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
568577-82-2 2-metil-5-fenil-3-furil-izocianát |
|
termék neve | 2-metil-5-fenil-3-furil-izocianát |
Szinonimák | 3-izocianáto-2-metil-5-fenilfurán; |
Angol név | 2-Methyl-5-phenyl-3-furyl isocyanate;3-isocyanato-2-methyl-5-phenylfuran |
MF | C12H9NO2 |
Molekulatömeg | 199.2054 |
InChI | InChI=1/C12H9NO2/c1-9-11(13-8-14)7-12(15-9)10-5-3-2-4-6-10/h2-7H,1H3 |
CAS-szám | 568577-82-2 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.12g/cm3 |
Forráspont | 306.9°C at 760 mmHg |
Törésmutató | 1.569 |
Gyulladáspont | 139.4°C |
Gőznyomás | 0.000747mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |