ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
568577-82-2 2-متیل-5-فنیل-3-furyl ایزووسیانات؛ 3-isocyanato-2-متیل-5-فنیلفوران؛ |
|
نام محصول | 2-متیل-5-فنیل-3-furyl ایزووسیانات؛ 3-isocyanato-2-متیل-5-فنیلفوران؛ |
نام انگلیسی | 2-Methyl-5-phenyl-3-furyl isocyanate;3-isocyanato-2-methyl-5-phenylfuran |
میدان مغناطیسی | C12H9NO2 |
وزن مولکولی | 199.2054 |
InChI | InChI=1/C12H9NO2/c1-9-11(13-8-14)7-12(15-9)10-5-3-2-4-6-10/h2-7H,1H3 |
شماره سیایاس | 568577-82-2 |
ساختار مولکولی | ![]() |
تراکم | 1.12g/cm3 |
نقطه غلیان | 306.9°C at 760 mmHg |
ضریب شکست | 1.569 |
نقطه اشتعال | 139.4°C |
فشار بخار | 0.000747mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |