ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
568577-82-2 2-Metil-5-fenil-3-furil isosianat |
|
Nama produk | 2-Metil-5-fenil-3-furil isosianat |
Sinonim | 3-isosianat-2-metil-5-fenilfuran; |
Nama bahasa Inggris | 2-Methyl-5-phenyl-3-furyl isocyanate;3-isocyanato-2-methyl-5-phenylfuran |
MF | C12H9NO2 |
Berat Molekul | 199.2054 |
InChI | InChI=1/C12H9NO2/c1-9-11(13-8-14)7-12(15-9)10-5-3-2-4-6-10/h2-7H,1H3 |
CAS NO | 568577-82-2 |
Struktur Molekul | ![]() |
Kepadatan | 1.12g/cm3 |
Titik didih | 306.9°C at 760 mmHg |
Indeks bias | 1.569 |
Titik nyala | 139.4°C |
Tekanan uap | 0.000747mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |