ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
568577-82-2 izocyjanian 2-metylo-5-fenylo-3-furylu |
|
| Nazwa produktu: | izocyjanian 2-metylo-5-fenylo-3-furylu |
| Synonimy | 3-izocyjanato-2-metylo-5-fenylofuran; |
| Angielska nazwa | 2-Methyl-5-phenyl-3-furyl isocyanate;3-isocyanato-2-methyl-5-phenylfuran |
| MF | C12H9NO2 |
| Masie cząsteczkowej | 199.2054 |
| InChI | InChI=1/C12H9NO2/c1-9-11(13-8-14)7-12(15-9)10-5-3-2-4-6-10/h2-7H,1H3 |
| Nr CAS | 568577-82-2 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.12g/cm3 |
| Temperatura wrzenia | 306.9°C at 760 mmHg |
| Współczynnik załamania | 1.569 |
| Temperatura zapłonu | 139.4°C |
| Ciśnienie pary | 0.000747mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |