ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
568577-82-2 2-ميثيل-5-فينيل-3-فوريل أيزوسيانات ؛ 3-إيزوسياناتو-2-ميثيل-5-فينيل فوران ؛ |
|
اسم المنتج | 2-ميثيل-5-فينيل-3-فوريل أيزوسيانات ؛ 3-إيزوسياناتو-2-ميثيل-5-فينيل فوران ؛ |
الاسم بالانجليزية | 2-Methyl-5-phenyl-3-furyl isocyanate;3-isocyanato-2-methyl-5-phenylfuran |
الصيغة الجزيئية | C12H9NO2 |
الوزن الجزيئي الغرامي | 199.2054 |
InChI | InChI=1/C12H9NO2/c1-9-11(13-8-14)7-12(15-9)10-5-3-2-4-6-10/h2-7H,1H3 |
إستراتيجية المساعدة القطرية | 568577-82-2 |
بنية جزيئية | ![]() |
كثافة | 1.12g/cm3 |
نقطة الغليان | 306.9°C at 760 mmHg |
معامل الإنكسار | 1.569 |
نقطة الوميض | 139.4°C |
ضغط البخار | 0.000747mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |