ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
568577-82-2 2-מתיל-5-פניל-3-פוריל איזוציאנט |
|
שם המוצר | 2-מתיל-5-פניל-3-פוריל איזוציאנט |
נרדפות | 3-isocyanato-2-methyl-5-phenylfuran; |
שם אנגלי | 2-Methyl-5-phenyl-3-furyl isocyanate;3-isocyanato-2-methyl-5-phenylfuran |
מולקולרית פורמולה | C12H9NO2 |
משקל מולקולרי | 199.2054 |
InChl | InChI=1/C12H9NO2/c1-9-11(13-8-14)7-12(15-9)10-5-3-2-4-6-10/h2-7H,1H3 |
מספר CAS | 568577-82-2 |
מבנה מולקולרי | ![]() |
צפיפות | 1.12g/cm3 |
נקודת רתיחה | 306.9°C at 760 mmHg |
משקל סגולי | 1.569 |
נקודת הבזק | 139.4°C |
לחץ אדים | 0.000747mmHg at 25°C |
Hazard סימנים | |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |