Chemindex > 646-01-5
HU ▼
646-01-5 3-(Methylthio)propionic acid |
|
| termék neve | 3-(Methylthio)propionic acid |
| Angol név | 3-(Methylthio)propionic acid;3-Methythiopropionic acid;3-(methylsulfanyl)propanoate;3-Methylthiopropionic Acid |
| MF | C4H7O2S |
| Molekulatömeg | 119.1627 |
| InChI | InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| CAS-szám | 646-01-5 |
| EINECS | 211-460-9 |
| Molekuláris szerkezete |  |
| Forráspont | 249.2°C at 760 mmHg |
| Gyulladáspont | 104.5°C |
| Gőznyomás | 0.00741mmHg at 25°C |
| Kockázatot kódok | R34##Causes burns.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 