Chemindex > 646-01-5
NO ▼
646-01-5 3-(Methylthio)propionic acid |
|
| produktnavn | 3-(Methylthio)propionic acid |
| Engelsk navn | 3-(Methylthio)propionic acid;3-Methythiopropionic acid;3-(methylsulfanyl)propanoate;3-Methylthiopropionic Acid |
| Molekylær Formel | C4H7O2S |
| Molekylvekt | 119.1627 |
| InChI | InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| CAS-nummer | 646-01-5 |
| EINECS | 211-460-9 |
| Molecular Structure |  |
| Kokepunkt | 249.2°C at 760 mmHg |
| Flammepunktet | 104.5°C |
| Damptrykk | 0.00741mmHg at 25°C |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 