Chemindex > 646-01-5
KR ▼
646-01-5 3-(Methylthio)propionic acid |
|
| 상품명칭 | 3-(Methylthio)propionic acid |
| 영문 이름 | 3-(Methylthio)propionic acid;3-Methythiopropionic acid;3-(methylsulfanyl)propanoate;3-Methylthiopropionic Acid |
| 분자식 | C4H7O2S |
| 분자량 | 119.1627 |
| InChI | InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| cas번호 | 646-01-5 |
| EC번호 | 211-460-9 |
| 분자 구조 |  |
| 비등점 | 249.2°C at 760 mmHg |
| 인화점 | 104.5°C |
| 증기압 | 0.00741mmHg at 25°C |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 