Chemindex > 646-01-5
IT ▼
646-01-5 3-(Methylthio)propionic acid |
|
| Nome del prodotto | 3-(Methylthio)propionic acid |
| Nome inglese | 3-(Methylthio)propionic acid;3-Methythiopropionic acid;3-(methylsulfanyl)propanoate;3-Methylthiopropionic Acid |
| Formula molecolare | C4H7O2S |
| Peso Molecolare | 119.1627 |
| InChI | InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| Numero CAS | 646-01-5 |
| EINECS | 211-460-9 |
| Struttura molecolare |  |
| Punto di ebollizione | 249.2°C at 760 mmHg |
| Punto d'infiammabilità | 104.5°C |
| Pressione di vapore | 0.00741mmHg at 25°C |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Il servizio di database CAS chimico è fornito da ChemIndex.com 