ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
646-01-5 3-(Methylthio)propionic acid |
|
| نام محصول | 3-(Methylthio)propionic acid |
| نام انگلیسی | 3-(Methylthio)propionic acid;3-Methythiopropionic acid;3-(methylsulfanyl)propanoate;3-Methylthiopropionic Acid |
| میدان مغناطیسی | C4H7O2S |
| وزن مولکولی | 119.1627 |
| InChI | InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| شماره سیایاس | 646-01-5 |
| تعداد کمیسیون اروپایی | 211-460-9 |
| ساختار مولکولی | ![]() |
| نقطه غلیان | 249.2°C at 760 mmHg |
| نقطه اشتعال | 104.5°C |
| فشار بخار | 0.00741mmHg at 25°C |
| کدهای خطر | R34##Causes burns.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |