Chemindex > 646-01-5
SA ▼
646-01-5 3-(Methylthio)propionic acid |
|
| اسم المنتج | 3-(Methylthio)propionic acid |
| الاسم بالانجليزية | 3-(Methylthio)propionic acid;3-Methythiopropionic acid;3-(methylsulfanyl)propanoate;3-Methylthiopropionic Acid |
| الصيغة الجزيئية | C4H7O2S |
| الوزن الجزيئي الغرامي | 119.1627 |
| InChI | InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| إستراتيجية المساعدة القطرية | 646-01-5 |
| المفوضية الأوروبية رقم | 211-460-9 |
| بنية جزيئية |  |
| نقطة الغليان | 249.2°C at 760 mmHg |
| نقطة الوميض | 104.5°C |
| ضغط البخار | 0.00741mmHg at 25°C |
| خطر المصطلحات | R34##Causes burns.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 