ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68345-30-2 Bórsav, 2,2'-iminobisz[etanollal] és 2,2',2''-nitrilotrisszal[etanollal] együtt |
|
termék neve | Bórsav, 2,2'-iminobisz[etanollal] és 2,2',2''-nitrilotrisszal[etanollal] együtt |
Szinonimák | Bórsav, compd.2,2'-iminobisz(etanol) és 2,2',2'-nitrilotyris(etanol); Bórsav, dietanol-amin, trietanol-amin só; 2-(bisz(2-hidroxietil)amino)etanol; bórsav; 2-(2-hidroxietil-amino)etanol; |
Angol név | Boric acid, compd. with 2,2'-iminobis[ethanol] and 2,2',2''-nitrilotris[ethanol];Boric acid, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);Boric acid, diethanolamine, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; boric acid; 2-(2-hydroxyethylamino)ethanol |
MF | C10H29BN2O8 |
Molekulatömeg | 316.1569 |
InChI | InChI=1/C6H15NO3.C4H11NO2.BH3O3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;2-1(3)4/h8-10H,1-6H2;5-7H,1-4H2;2-4H |
CAS-szám | 68345-30-2 |
EINECS | 269-852-0 |
Molekuláris szerkezete | ![]() |
Forráspont | 335.4°C at 760 mmHg |
Gyulladáspont | 185°C |
Gőznyomás | 8.38E-06mmHg at 25°C |
MSDS |