Chemindex > 68345-30-2
KR ▼
68345-30-2 붕산, compd.with 2,2'-iminobis [에탄올] 및 2,2',2''-니트릴로트리스 [에탄올] |
|
| 상품명칭 | 붕산, compd.with 2,2'-iminobis [에탄올] 및 2,2',2''-니트릴로트리스 [에탄올] |
| 별명 | 붕산, compd.2,2'-iminobis(에탄올) 및 2,2',2''-nitrilotris(에탄올); 붕산, 디 에탄올 아민, 트리에탄올 아민 염; 2-(비스(2-하이드록시에틸)아미노)에탄올; 붕산; 2-(2-하이드록시에틸아미노)에탄올; |
| 영문 이름 | Boric acid, compd. with 2,2'-iminobis[ethanol] and 2,2',2''-nitrilotris[ethanol];Boric acid, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);Boric acid, diethanolamine, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; boric acid; 2-(2-hydroxyethylamino)ethanol |
| 분자식 | C10H29BN2O8 |
| 분자량 | 316.1569 |
| InChI | InChI=1/C6H15NO3.C4H11NO2.BH3O3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;2-1(3)4/h8-10H,1-6H2;5-7H,1-4H2;2-4H |
| cas번호 | 68345-30-2 |
| EC번호 | 269-852-0 |
| 분자 구조 | ![68345-30-2 붕산, compd.with 2,2'-iminobis [에탄올] 및 2,2',2''-니트릴로트리스 [에탄올]](https://images-a.chemnet.com/suppliers/chembase/cas6/cas68345-30-2.gif "68345-30-2 붕산, compd.with 2,2'-iminobis [에탄올] 및 2,2',2''-니트릴로트리스 [에탄올]") |
| 비등점 | 335.4°C at 760 mmHg |
| 인화점 | 185°C |
| 증기압 | 8.38E-06mmHg at 25°C |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
68345-30-2 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 