ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68345-30-2 बोरिक एसिड, compd.with 2,2'-iminobis [इथेनॉल] और 2,2', 2''-नाइट्रिलोट्रिस [इथेनॉल] |
|
उत्पाद का नाम | बोरिक एसिड, compd.with 2,2'-iminobis [इथेनॉल] और 2,2', 2''-नाइट्रिलोट्रिस [इथेनॉल] |
समानार्थी | बोरिक एसिड, compd।2,2'-इमिनोबिस (इथेनॉल) और 2,2', 2''-नाइट्रिलोट्रिस (इथेनॉल) के साथ; बोरिक एसिड, डायथेनॉलमाइन, ट्राइथेनॉलमाइन नमक; 2- (बीआईएस (2-हाइड्रॉक्सीएथिल) एमिनो) इथेनॉल; बोरिक एसिड; 2- (2-हाइड्रोक्सीएथाइलामिनो) इथेनॉल; |
अंग्रेज | Boric acid, compd. with 2,2'-iminobis[ethanol] and 2,2',2''-nitrilotris[ethanol];Boric acid, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);Boric acid, diethanolamine, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; boric acid; 2-(2-hydroxyethylamino)ethanol |
आणविक फार्मूला | C10H29BN2O8 |
आण्विक वजन | 316.1569 |
InChI | InChI=1/C6H15NO3.C4H11NO2.BH3O3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;2-1(3)4/h8-10H,1-6H2;5-7H,1-4H2;2-4H |
कैस रजिस्टी संख्या | 68345-30-2 |
EINECS | 269-852-0 |
आणविक संरचना | ![]() |
उबलने का समय | 335.4°C at 760 mmHg |
फ्लैश प्वाइंट | 185°C |
वाष्प का दबाव | 8.38E-06mmHg at 25°C |
MSDS |