Chemindex >68345-30-2
MY ▼
68345-30-2 Asid borik, compd.with 2,2'-iminobis[etanol] dan 2,2',2'-nitrilotris[etanol] |
|
| Nama produk | Asid borik, compd.with 2,2'-iminobis[etanol] dan 2,2',2'-nitrilotris[etanol] |
| Sinonim | Asid borik, akaun.dengan 2,2'-iminobis(etanol) dan 2,2',2'-nitrilotris(etanol); Asid borik, diethanolamine, garam triethanolamine; 2-(bis(2-hydroxyethyl)amino)etanol; asid borik; 2-(2-hydroxyethylamino)etanol; |
| Nama Inggeris | Boric acid, compd. with 2,2'-iminobis[ethanol] and 2,2',2''-nitrilotris[ethanol];Boric acid, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);Boric acid, diethanolamine, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; boric acid; 2-(2-hydroxyethylamino)ethanol |
| MF | C10H29BN2O8 |
| Berat Molekul | 316.1569 |
| InChI | InChI=1/C6H15NO3.C4H11NO2.BH3O3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;2-1(3)4/h8-10H,1-6H2;5-7H,1-4H2;2-4H |
| CAS NO | 68345-30-2 |
| EINECS | 269-852-0 |
| Struktur Molekul | ![68345-30-2 Asid borik, compd.with 2,2'-iminobis[etanol] dan 2,2',2'-nitrilotris[etanol]](https://images-a.chemnet.com/suppliers/chembase/cas6/cas68345-30-2.gif "68345-30-2 Asid borik, compd.with 2,2'-iminobis[etanol] dan 2,2',2'-nitrilotris[etanol]") |
| Titik didih | 335.4°C at 760 mmHg |
| Titik nyala | 185°C |
| Tekanan wap | 8.38E-06mmHg at 25°C |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 68345-30-2 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 