Chemindex > 68345-30-2
TR ▼
68345-30-2 Borik asit, 2,2'-iminobis[etanol] ve 2,2',2''-nitrilotris [etanol] |
|
| Ürün Adı | Borik asit, 2,2'-iminobis[etanol] ve 2,2',2''-nitrilotris [etanol] |
| Eş anlamlı | Borik asit, compd.2,2'-iminobis(etanol) ve 2,2',2''-nitrilotris (etanol) ile; Borik asit, dietanolamin, trietanolamin tuzu; 2- (bis (2-hidroksietil) amino) etanol; borik asit; 2- (2-hidroksietilamino) etanol; |
| ingilizce adı | Boric acid, compd. with 2,2'-iminobis[ethanol] and 2,2',2''-nitrilotris[ethanol];Boric acid, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);Boric acid, diethanolamine, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; boric acid; 2-(2-hydroxyethylamino)ethanol |
| Moleküler Formülü | C10H29BN2O8 |
| Molekül Ağırlığı | 316.1569 |
| InChI | InChI=1/C6H15NO3.C4H11NO2.BH3O3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;2-1(3)4/h8-10H,1-6H2;5-7H,1-4H2;2-4H |
| CAS kayıt numarası | 68345-30-2 |
| EINECS | 269-852-0 |
| Moleküler Yapısı | ![68345-30-2 Borik asit, 2,2'-iminobis[etanol] ve 2,2',2''-nitrilotris [etanol]](https://images-a.chemnet.com/suppliers/chembase/cas6/cas68345-30-2.gif "68345-30-2 Borik asit, 2,2'-iminobis[etanol] ve 2,2',2''-nitrilotris [etanol]") |
| Kaynama noktası | 335.4°C at 760 mmHg |
| Alevlenme noktası | 185°C |
| Buhar basıncı | 8.38E-06mmHg at 25°C |
| MSDS | |
- Çin'den kimyasal tedarik etmeyi planlıyorsanız, sadece ChemNet alışveriş merkezine gidin, sizin için Çinli üreticilerden en son ve rekabetçi fiyatı alacağız.Lütfen ziyaret edin
ChemNet Mall
68345-30-2 (0) için tedarikçiler:
Chemical CAS Veritabanı Hizmeti, ChemIndex.com tarafından sağlanmaktadır. 