ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68345-30-2 Borsyre, compd.with 2,2'-iminobis[etanol] og 2,2',2''-nitrilotris[etanol] |
|
produktnavn | Borsyre, compd.with 2,2'-iminobis[etanol] og 2,2',2''-nitrilotris[etanol] |
Synonymer | Borsyre, compd.med 2,2'-iminobis(etanol) og 2,2',2''-nitrilotris (etanol); Borsyre, dietanolamin, trietanolaminsalt; 2-(bis(2-hydroksyetyl)amino)etanol; borsyre; 2-(2-hydroksyetylamino)etanol; |
Engelsk navn | Boric acid, compd. with 2,2'-iminobis[ethanol] and 2,2',2''-nitrilotris[ethanol];Boric acid, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);Boric acid, diethanolamine, triethanolamine salt;2-(bis(2-hydroxyethyl)amino)ethanol; boric acid; 2-(2-hydroxyethylamino)ethanol |
Molekylær Formel | C10H29BN2O8 |
Molekylvekt | 316.1569 |
InChI | InChI=1/C6H15NO3.C4H11NO2.BH3O3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;2-1(3)4/h8-10H,1-6H2;5-7H,1-4H2;2-4H |
CAS-nummer | 68345-30-2 |
EINECS | 269-852-0 |
Molecular Structure | ![]() |
Kokepunkt | 335.4°C at 760 mmHg |
Flammepunktet | 185°C |
Damptrykk | 8.38E-06mmHg at 25°C |
MSDS |