ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
928-47-2 S-n-Butyl thioacetate |
|
שם המוצר | S-n-Butyl thioacetate |
שם אנגלי | S-n-Butyl thioacetate;Thioacetic acid S-n-butyl ester;S-butyl ethanethioate;S-butan-2-yl ethanethioate |
מולקולרית פורמולה | C6H12OS |
משקל מולקולרי | 132.2239 |
InChl | InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
מספר CAS | 928-47-2 |
מבנה מולקולרי | ![]() |
צפיפות | 0.95g/cm3 |
נקודת רתיחה | 158.1°C at 760 mmHg |
משקל סגולי | 1.456 |
נקודת הבזק | 44°C |
לחץ אדים | 2.67mmHg at 25°C |
סיכונים קודי | R10##Flammable.:; |
בטיחות תיאור | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |