ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
928-47-2 S-n-Butyl thioacetate |
|
produktnavn | S-n-Butyl thioacetate |
Engelsk navn | S-n-Butyl thioacetate;Thioacetic acid S-n-butyl ester;S-butyl ethanethioate;S-butan-2-yl ethanethioate |
Molekylær Formel | C6H12OS |
Molekylvekt | 132.2239 |
InChI | InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
CAS-nummer | 928-47-2 |
Molecular Structure | ![]() |
Tetthet | 0.95g/cm3 |
Kokepunkt | 158.1°C at 760 mmHg |
Brytningsindeks | 1.456 |
Flammepunktet | 44°C |
Damptrykk | 2.67mmHg at 25°C |
Risiko Koder | R10##Flammable.:; |
Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |