ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
928-47-2 S-n-Butyl thioacetate |
|
Nazwa produktu: | S-n-Butyl thioacetate |
Angielska nazwa | S-n-Butyl thioacetate;Thioacetic acid S-n-butyl ester;S-butyl ethanethioate;S-butan-2-yl ethanethioate |
MF | C6H12OS |
Masie cząsteczkowej | 132.2239 |
InChI | InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
Nr CAS | 928-47-2 |
Struktury molekularnej | ![]() |
Gęstość | 0.95g/cm3 |
Temperatura wrzenia | 158.1°C at 760 mmHg |
Współczynnik załamania | 1.456 |
Temperatura zapłonu | 44°C |
Ciśnienie pary | 2.67mmHg at 25°C |
Kody ryzyka | R10##Flammable.:; |
Bezpieczeństwo opis | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |