ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
928-47-2 S-n-Butyl thioacetate |
|
उत्पाद का नाम | S-n-Butyl thioacetate |
अंग्रेज | S-n-Butyl thioacetate;Thioacetic acid S-n-butyl ester;S-butyl ethanethioate;S-butan-2-yl ethanethioate |
आणविक फार्मूला | C6H12OS |
आण्विक वजन | 132.2239 |
InChI | InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
कैस रजिस्टी संख्या | 928-47-2 |
आणविक संरचना | ![]() |
घनत्व | 0.95g/cm3 |
उबलने का समय | 158.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.456 |
फ्लैश प्वाइंट | 44°C |
वाष्प का दबाव | 2.67mmHg at 25°C |
खतरे के कोड | R10##Flammable.:; |
सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |