ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
928-47-2 S-n-Butyl thioacetate |
|
Ürün Adı | S-n-Butyl thioacetate |
ingilizce adı | S-n-Butyl thioacetate;Thioacetic acid S-n-butyl ester;S-butyl ethanethioate;S-butan-2-yl ethanethioate |
Moleküler Formülü | C6H12OS |
Molekül Ağırlığı | 132.2239 |
InChI | InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
CAS kayıt numarası | 928-47-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.95g/cm3 |
Kaynama noktası | 158.1°C at 760 mmHg |
Kırılma indisi | 1.456 |
Alevlenme noktası | 44°C |
Buhar basıncı | 2.67mmHg at 25°C |
Risk Kodları | R10##Flammable.:; |
Güvenlik Açıklaması | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |