ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
928-47-2 S-n-Butyl thioacetate |
|
نام محصول | S-n-Butyl thioacetate |
نام انگلیسی | S-n-Butyl thioacetate;Thioacetic acid S-n-butyl ester;S-butyl ethanethioate;S-butan-2-yl ethanethioate |
میدان مغناطیسی | C6H12OS |
وزن مولکولی | 132.2239 |
InChI | InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
شماره سیایاس | 928-47-2 |
ساختار مولکولی | ![]() |
تراکم | 0.95g/cm3 |
نقطه غلیان | 158.1°C at 760 mmHg |
ضریب شکست | 1.456 |
نقطه اشتعال | 44°C |
فشار بخار | 2.67mmHg at 25°C |
کدهای خطر | R10##Flammable.:; |
توضیحات ایمنی | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |