ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid |
|
نام محصول | 4-Bromo-2-fluorobenzeneboronic acid |
نام انگلیسی | 4-Bromo-2-fluorobenzeneboronic acid;4-Bromo-2-fluorophenylboronic acid |
میدان مغناطیسی | C6H5BBrFO2 |
وزن مولکولی | 218.8161 |
InChI | InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
شماره سیایاس | 216393-64-5 |
ساختار مولکولی | ![]() |
تراکم | 1.75g/cm3 |
نقطه غلیان | 310.6°C at 760 mmHg |
ضریب شکست | 1.571 |
نقطه اشتعال | 141.6°C |
فشار بخار | 0.000255mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |