ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid |
|
Nazwa produktu: | 4-Bromo-2-fluorobenzeneboronic acid |
Angielska nazwa | 4-Bromo-2-fluorobenzeneboronic acid;4-Bromo-2-fluorophenylboronic acid |
MF | C6H5BBrFO2 |
Masie cząsteczkowej | 218.8161 |
InChI | InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
Nr CAS | 216393-64-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.75g/cm3 |
Temperatura wrzenia | 310.6°C at 760 mmHg |
Współczynnik załamania | 1.571 |
Temperatura zapłonu | 141.6°C |
Ciśnienie pary | 0.000255mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |