ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid |
|
Nama produk | 4-Bromo-2-fluorobenzeneboronic acid |
Nama Inggeris | 4-Bromo-2-fluorobenzeneboronic acid;4-Bromo-2-fluorophenylboronic acid |
MF | C6H5BBrFO2 |
Berat Molekul | 218.8161 |
InChI | InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
CAS NO | 216393-64-5 |
Struktur Molekul | ![]() |
Kepadatan | 1.75g/cm3 |
Titik didih | 310.6°C at 760 mmHg |
Indeks bias | 1.571 |
Titik nyala | 141.6°C |
Tekanan wap | 0.000255mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |