ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid |
|
Naam product | 4-Bromo-2-fluorobenzeneboronic acid |
Engelse naam | 4-Bromo-2-fluorobenzeneboronic acid;4-Bromo-2-fluorophenylboronic acid |
MF | C6H5BBrFO2 |
Molecuulgewicht | 218.8161 |
InChI | InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
CAS-nummer | 216393-64-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.75g/cm3 |
Kookpunt | 310.6°C at 760 mmHg |
Brekingsindex | 1.571 |
Vlampunt | 141.6°C |
Dampdruk | 0.000255mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |