ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid |
|
Ürün Adı | 4-Bromo-2-fluorobenzeneboronic acid |
ingilizce adı | 4-Bromo-2-fluorobenzeneboronic acid;4-Bromo-2-fluorophenylboronic acid |
Moleküler Formülü | C6H5BBrFO2 |
Molekül Ağırlığı | 218.8161 |
InChI | InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
CAS kayıt numarası | 216393-64-5 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.75g/cm3 |
Kaynama noktası | 310.6°C at 760 mmHg |
Kırılma indisi | 1.571 |
Alevlenme noktası | 141.6°C |
Buhar basıncı | 0.000255mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |