ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid |
|
상품명칭 | 4-Bromo-2-fluorobenzeneboronic acid |
영문 이름 | 4-Bromo-2-fluorobenzeneboronic acid;4-Bromo-2-fluorophenylboronic acid |
분자식 | C6H5BBrFO2 |
분자량 | 218.8161 |
InChI | InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
cas번호 | 216393-64-5 |
분자 구조 | ![]() |
밀도 | 1.75g/cm3 |
비등점 | 310.6°C at 760 mmHg |
굴절 지수 | 1.571 |
인화점 | 141.6°C |
증기압 | 0.000255mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |