ChemIndex - Bezplatná chemická databáze CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride |
|
název výrobku | 2,6-Difluoro-3-methylbenzoyl chloride |
Anglický název | 2,6-Difluoro-3-methylbenzoyl chloride;2,6-Difluoro-m-toluoyl chloride |
Molekulární vzorec | C8H5ClF2O |
Molekulová hmotnost | 190.5745 |
InChl | InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
Registrační číslo CAS | 261763-39-7 |
Molekulární struktura | ![]() |
Hustota | 1.356g/cm3 |
Bod varu | 203.1°C at 760 mmHg |
Index lomu | 1.499 |
Bod vzplanutí | 76.7°C |
Tlak par | 0.282mmHg at 25°C |
Riziko Codes | R34##Causes burns.:; |
Bezpečnostní Popis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |